C11H18N2O2 — CID 66398300
methyl 4-amino-5-(1-methylpyrrol-3-yl)pentanoate (PubChem CID 66398300) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is methyl 4-amino-5-(1-methylpyrrol-3-yl)pentanoate.
| Compound Name | methyl 4-amino-5-(1-methylpyrrol-3-yl)pentanoate |
|---|---|
| PubChem CID | 66398300 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | methyl 4-amino-5-(1-methylpyrrol-3-yl)pentanoate |
| SMILES | COC(=O)CCC(N)Cc1ccn(C)c1 |
| InChI | InChI=1S/C11H18N2O2/c1-13-6-5-9(8-13)7-10(12)3-4-11(14)15-2/h5-6,8,10H,3-4,7,12H2,1-2H3 |
| InChIKey | QQAIXUWQRHKRLU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |