About [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol
[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol (PubChem CID 66398925) has the molecular formula C10H14F3NO2
and a molecular weight of 237.22 g/mol. Its IUPAC name is [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol |
| PubChem CID | 66398925 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol |
| SMILES | OCc1ccn(CCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H14F3NO2/c11-10(12,13)8-16-5-1-3-14-4-2-9(6-14)7-15/h2,4,6,15H,1,3,5,7-8H2 |
| InChIKey | SOTYXRSGODIZKM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol?
The IUPAC name of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol (CID 66398925) is [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol.
What is the SMILES notation for [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol?
The canonical SMILES for [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol is OCc1ccn(CCCOCC(F)(F)F)c1.
What is the InChIKey of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol?
The InChIKey is SOTYXRSGODIZKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO2/c11-10(12,13)8-16-5-1-3-14-4-2-9(6-14)7-15/h2,4,6,15H,1,3,5,7-8H2.
What are the key properties of [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol?
[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol has a molecular weight of 237.22 g/mol, XLogP of 1.95, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]methanol is sourced from PubChem (CID 66398925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).