C12H20N2O — CID 66400247
[1-[(1-methylpyrrol-3-yl)methylamino]cyclopentyl]methanol (PubChem CID 66400247) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is [1-[(1-methylpyrrol-3-yl)methylamino]cyclopentyl]methanol.
| Compound Name | [1-[(1-methylpyrrol-3-yl)methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 66400247 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [1-[(1-methylpyrrol-3-yl)methylamino]cyclopentyl]methanol |
| SMILES | Cn1ccc(CNC2(CO)CCCC2)c1 |
| InChI | InChI=1S/C12H20N2O/c1-14-7-4-11(9-14)8-13-12(10-15)5-2-3-6-12/h4,7,9,13,15H,2-3,5-6,8,10H2,1H3 |
| InChIKey | BBGFHAUWTGPGJQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |