C16H19ClN2O2 — CID 66400303
methyl 4-chloro-2-[(1-propylpyrrol-3-yl)methylamino]benzoate (PubChem CID 66400303) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is methyl 4-chloro-2-[(1-propylpyrrol-3-yl)methylamino]benzoate.
| Compound Name | methyl 4-chloro-2-[(1-propylpyrrol-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 66400303 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | methyl 4-chloro-2-[(1-propylpyrrol-3-yl)methylamino]benzoate |
| SMILES | CCCn1ccc(CNc2cc(Cl)ccc2C(=O)OC)c1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-3-7-19-8-6-12(11-19)10-18-15-9-13(17)4-5-14(15)16(20)21-2/h4-6,8-9,11,18H,3,7,10H2,1-2H3 |
| InChIKey | CDKXCSUKQLMBJI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |