C14H26N2O — CID 66402617
5-[2-[(2-methylpropylamino)methyl]pyrrol-1-yl]pentan-1-ol (PubChem CID 66402617) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 5-[2-[(2-methylpropylamino)methyl]pyrrol-1-yl]pentan-1-ol.
| Compound Name | 5-[2-[(2-methylpropylamino)methyl]pyrrol-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 66402617 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 5-[2-[(2-methylpropylamino)methyl]pyrrol-1-yl]pentan-1-ol |
| SMILES | CC(C)CNCc1cccn1CCCCCO |
| InChI | InChI=1S/C14H26N2O/c1-13(2)11-15-12-14-7-6-9-16(14)8-4-3-5-10-17/h6-7,9,13,15,17H,3-5,8,10-12H2,1-2H3 |
| InChIKey | AVOYABIUCOFFPO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|