C14H19BrN2S — CID 66402996
N-[[1-[(4-bromothiophen-2-yl)methyl]pyrrol-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 66402996) has the molecular formula C14H19BrN2S and a molecular weight of 327.29 g/mol. Its IUPAC name is N-[[1-[(4-bromothiophen-2-yl)methyl]pyrrol-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[(4-bromothiophen-2-yl)methyl]pyrrol-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 66402996 |
| Molecular Formula | C14H19BrN2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-[[1-[(4-bromothiophen-2-yl)methyl]pyrrol-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cccn1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C14H19BrN2S/c1-14(2,3)16-8-12-5-4-6-17(12)9-13-7-11(15)10-18-13/h4-7,10,16H,8-9H2,1-3H3 |
| InChIKey | DAIVWCRQOHHGAS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |