About 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile
5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile (PubChem CID 66403383) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile |
| PubChem CID | 66403383 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCn1cccc1CNC(C)(C)C |
| InChI | InChI=1S/C16H27N3/c1-15(2,3)18-12-14-8-6-10-19(14)11-7-9-16(4,5)13-17/h6,8,10,18H,7,9,11-12H2,1-5H3 |
| InChIKey | CEMTYTQIOMFAEI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile?
The IUPAC name of 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile (CID 66403383) is 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile is CC(C)(C#N)CCCn1cccc1CNC(C)(C)C.
What is the InChIKey of 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile?
The InChIKey is CEMTYTQIOMFAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3/c1-15(2,3)18-12-14-8-6-10-19(14)11-7-9-16(4,5)13-17/h6,8,10,18H,7,9,11-12H2,1-5H3.
What are the key properties of 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile?
5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile has a molecular weight of 261.41 g/mol, XLogP of 3.71, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[(tert-butylamino)methyl]pyrrol-1-yl]-2,2-dimethylpentanenitrile is sourced from PubChem (CID 66403383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).