About 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine
2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine (PubChem CID 66404025) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine |
| PubChem CID | 66404025 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine |
| SMILES | Cc1cc(Cn2cccc2CCN)n(C)n1 |
| InChI | InChI=1S/C12H18N4/c1-10-8-12(15(2)14-10)9-16-7-3-4-11(16)5-6-13/h3-4,7-8H,5-6,9,13H2,1-2H3 |
| InChIKey | BESMZSUMZTXHTP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine?
The IUPAC name of 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine (CID 66404025) is 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine.
What is the SMILES notation for 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine?
The canonical SMILES for 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine is Cc1cc(Cn2cccc2CCN)n(C)n1.
What is the InChIKey of 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine?
The InChIKey is BESMZSUMZTXHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-10-8-12(15(2)14-10)9-16-7-3-4-11(16)5-6-13/h3-4,7-8H,5-6,9,13H2,1-2H3.
What are the key properties of 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine?
2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine has a molecular weight of 218.30 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrol-2-yl]ethanamine is sourced from PubChem (CID 66404025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).