C11H16N2O2 — CID 66404148
methyl 2-[3-[(cyclopropylamino)methyl]pyrrol-1-yl]acetate (PubChem CID 66404148) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 2-[3-[(cyclopropylamino)methyl]pyrrol-1-yl]acetate.
| Compound Name | methyl 2-[3-[(cyclopropylamino)methyl]pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 66404148 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | methyl 2-[3-[(cyclopropylamino)methyl]pyrrol-1-yl]acetate |
| SMILES | COC(=O)Cn1ccc(CNC2CC2)c1 |
| InChI | InChI=1S/C11H16N2O2/c1-15-11(14)8-13-5-4-9(7-13)6-12-10-2-3-10/h4-5,7,10,12H,2-3,6,8H2,1H3 |
| InChIKey | QPDAPQHLFPCVKX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |