C15H17N3 — CID 66404684
4-[[3-(2-aminopropyl)pyrrol-1-yl]methyl]benzonitrile (PubChem CID 66404684) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-[[3-(2-aminopropyl)pyrrol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-(2-aminopropyl)pyrrol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 66404684 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-[[3-(2-aminopropyl)pyrrol-1-yl]methyl]benzonitrile |
| SMILES | CC(N)Cc1ccn(Cc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C15H17N3/c1-12(17)8-15-6-7-18(11-15)10-14-4-2-13(9-16)3-5-14/h2-7,11-12H,8,10,17H2,1H3 |
| InChIKey | DIWUNZINNLDDRO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |