C14H17BrN2O — CID 66405437
2-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrrol-3-yl]ethanamine (PubChem CID 66405437) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrrol-3-yl]ethanamine.
| Compound Name | 2-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 66405437 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[1-[(2-bromo-5-methoxyphenyl)methyl]pyrrol-3-yl]ethanamine |
| SMILES | COc1ccc(Br)c(Cn2ccc(CCN)c2)c1 |
| InChI | InChI=1S/C14H17BrN2O/c1-18-13-2-3-14(15)12(8-13)10-17-7-5-11(9-17)4-6-16/h2-3,5,7-9H,4,6,10,16H2,1H3 |
| InChIKey | ONCZBTSWFOIEAS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |