C17H24N2 — CID 66405935
N-[[1-[(3,5-dimethylphenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine (PubChem CID 66405935) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-[[1-[(3,5-dimethylphenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(3,5-dimethylphenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66405935 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-[[1-[(3,5-dimethylphenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccn(Cc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C17H24N2/c1-4-6-18-11-16-5-7-19(12-16)13-17-9-14(2)8-15(3)10-17/h5,7-10,12,18H,4,6,11,13H2,1-3H3 |
| InChIKey | BSXPQXMFFAQLLG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|