C12H22N2O — CID 66406021
N-[(1-butylpyrrol-3-yl)methyl]-2-methoxyethanamine (PubChem CID 66406021) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(1-butylpyrrol-3-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(1-butylpyrrol-3-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66406021 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[(1-butylpyrrol-3-yl)methyl]-2-methoxyethanamine |
| SMILES | CCCCn1ccc(CNCCOC)c1 |
| InChI | InChI=1S/C12H22N2O/c1-3-4-7-14-8-5-12(11-14)10-13-6-9-15-2/h5,8,11,13H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | SZTICEKQPNCBJN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|