C15H14N6 — CID 664061
10-methyl-4-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 664061) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is 10-methyl-4-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-methyl-4-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 664061 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 10-methyl-4-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cn1ncc2c1ncn1nc(CCc3ccccc3)nc21 |
| InChI | InChI=1S/C15H14N6/c1-20-14-12(9-17-20)15-18-13(19-21(15)10-16-14)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | PBABZDHXDUJKLR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |