About [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine
[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine (PubChem CID 66407282) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine |
| PubChem CID | 66407282 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine |
| SMILES | Cc1noc(Cn2cc(CN)c3ccccc32)n1 |
| InChI | InChI=1S/C13H14N4O/c1-9-15-13(18-16-9)8-17-7-10(6-14)11-4-2-3-5-12(11)17/h2-5,7H,6,8,14H2,1H3 |
| InChIKey | JKXYSSDILUKHNN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine?
The IUPAC name of [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine (CID 66407282) is [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine.
What is the SMILES notation for [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine?
The canonical SMILES for [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine is Cc1noc(Cn2cc(CN)c3ccccc32)n1.
What is the InChIKey of [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine?
The InChIKey is JKXYSSDILUKHNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O/c1-9-15-13(18-16-9)8-17-7-10(6-14)11-4-2-3-5-12(11)17/h2-5,7H,6,8,14H2,1H3.
What are the key properties of [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine?
[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine has a molecular weight of 242.28 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indol-3-yl]methanamine is sourced from PubChem (CID 66407282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).