About N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine
N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine (PubChem CID 66407446) has the molecular formula C10H13N3S
and a molecular weight of 207.30 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine.
Molecular Properties
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine |
| PubChem CID | 66407446 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine |
| SMILES | Cc1ncc(CNCc2cc[nH]c2)s1 |
| InChI | InChI=1S/C10H13N3S/c1-8-13-7-10(14-8)6-12-5-9-2-3-11-4-9/h2-4,7,11-12H,5-6H2,1H3 |
| InChIKey | YIWLGDNBSKVPRB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine?
The IUPAC name of N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine (CID 66407446) is N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine.
What is the SMILES notation for N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine?
The canonical SMILES for N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine is Cc1ncc(CNCc2cc[nH]c2)s1.
What is the InChIKey of N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine?
The InChIKey is YIWLGDNBSKVPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S/c1-8-13-7-10(14-8)6-12-5-9-2-3-11-4-9/h2-4,7,11-12H,5-6H2,1H3.
What are the key properties of N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine?
N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine has a molecular weight of 207.30 g/mol, XLogP of 2.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine is sourced from PubChem (CID 66407446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).