About 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine
1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine (PubChem CID 66407448) has the molecular formula C9H11N3S
and a molecular weight of 193.28 g/mol. Its IUPAC name is 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine |
| PubChem CID | 66407448 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine |
| SMILES | c1csc(CNCc2cc[nH]c2)n1 |
| InChI | InChI=1S/C9H11N3S/c1-2-10-5-8(1)6-11-7-9-12-3-4-13-9/h1-5,10-11H,6-7H2 |
| InChIKey | PJICBEQPOAUZLI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
The IUPAC name of 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine (CID 66407448) is 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine.
What is the SMILES notation for 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
The canonical SMILES for 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine is c1csc(CNCc2cc[nH]c2)n1.
What is the InChIKey of 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
The InChIKey is PJICBEQPOAUZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S/c1-2-10-5-8(1)6-11-7-9-12-3-4-13-9/h1-5,10-11H,6-7H2.
What are the key properties of 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine has a molecular weight of 193.28 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrrol-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine is sourced from PubChem (CID 66407448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).