About [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine
[1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine (PubChem CID 66407745) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine |
| PubChem CID | 66407745 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine |
| SMILES | Cc1nnc(Cn2ccc(CN)c2)o1 |
| InChI | InChI=1S/C9H12N4O/c1-7-11-12-9(14-7)6-13-3-2-8(4-10)5-13/h2-3,5H,4,6,10H2,1H3 |
| InChIKey | HVXZDOPOCWGFQI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine?
The IUPAC name of [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine (CID 66407745) is [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine.
What is the SMILES notation for [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine?
The canonical SMILES for [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine is Cc1nnc(Cn2ccc(CN)c2)o1.
What is the InChIKey of [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine?
The InChIKey is HVXZDOPOCWGFQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-7-11-12-9(14-7)6-13-3-2-8(4-10)5-13/h2-3,5H,4,6,10H2,1H3.
What are the key properties of [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine?
[1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine has a molecular weight of 192.22 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]pyrrol-3-yl]methanamine is sourced from PubChem (CID 66407745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).