About [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine
[1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine (PubChem CID 66409050) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine.
Molecular Properties
| Compound Name | [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine |
| PubChem CID | 66409050 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine |
| SMILES | NCc1cccn1Cc1ncon1 |
| InChI | InChI=1S/C8H10N4O/c9-4-7-2-1-3-12(7)5-8-10-6-13-11-8/h1-3,6H,4-5,9H2 |
| InChIKey | GWPZQSLXGGEMHF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine?
The IUPAC name of [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine (CID 66409050) is [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine.
What is the SMILES notation for [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine?
The canonical SMILES for [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine is NCc1cccn1Cc1ncon1.
What is the InChIKey of [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine?
The InChIKey is GWPZQSLXGGEMHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-4-7-2-1-3-12(7)5-8-10-6-13-11-8/h1-3,6H,4-5,9H2.
What are the key properties of [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine?
[1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine has a molecular weight of 178.19 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,2,4-oxadiazol-3-ylmethyl)pyrrol-2-yl]methanamine is sourced from PubChem (CID 66409050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).