C18H18FNO3S — CID 664102
N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide (PubChem CID 664102) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide.
| Compound Name | N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 664102 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-fluorobenzamide |
| SMILES | O=C(c1ccccc1F)N(Cc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H18FNO3S/c19-17-9-5-4-8-16(17)18(21)20(12-14-6-2-1-3-7-14)15-10-11-24(22,23)13-15/h1-9,15H,10-13H2 |
| InChIKey | PQFWNWHQHPASTJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |