C15H16ClN3 — CID 66411132
2-chloro-5-[(1-propylpyrrol-2-yl)methylamino]benzonitrile (PubChem CID 66411132) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is 2-chloro-5-[(1-propylpyrrol-2-yl)methylamino]benzonitrile.
| Compound Name | 2-chloro-5-[(1-propylpyrrol-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 66411132 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-chloro-5-[(1-propylpyrrol-2-yl)methylamino]benzonitrile |
| SMILES | CCCn1cccc1CNc1ccc(Cl)c(C#N)c1 |
| InChI | InChI=1S/C15H16ClN3/c1-2-7-19-8-3-4-14(19)11-18-13-5-6-15(16)12(9-13)10-17/h3-6,8-9,18H,2,7,11H2,1H3 |
| InChIKey | UCFKVDUGQUSKCN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |