About butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate
butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate (PubChem CID 66411609) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate.
Molecular Properties
| Compound Name | butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate |
| PubChem CID | 66411609 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate |
| SMILES | CCCCOC(=O)Cn1cc(CNCC)c2cccnc21 |
| InChI | InChI=1S/C16H23N3O2/c1-3-5-9-21-15(20)12-19-11-13(10-17-4-2)14-7-6-8-18-16(14)19/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
| InChIKey | XHBPKLHYEPVZKB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
The IUPAC name of butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate (CID 66411609) is butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate.
What is the SMILES notation for butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
The canonical SMILES for butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate is CCCCOC(=O)Cn1cc(CNCC)c2cccnc21.
What is the InChIKey of butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
The InChIKey is XHBPKLHYEPVZKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-3-5-9-21-15(20)12-19-11-13(10-17-4-2)14-7-6-8-18-16(14)19/h6-8,11,17H,3-5,9-10,12H2,1-2H3.
What are the key properties of butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate has a molecular weight of 289.38 g/mol, XLogP of 2.49, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[3-(ethylaminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate is sourced from PubChem (CID 66411609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).