C16H21N3O2 — CID 66412138
4-methoxy-3-[(1-propylpyrrol-2-yl)methylamino]benzamide (PubChem CID 66412138) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-methoxy-3-[(1-propylpyrrol-2-yl)methylamino]benzamide.
| Compound Name | 4-methoxy-3-[(1-propylpyrrol-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 66412138 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-methoxy-3-[(1-propylpyrrol-2-yl)methylamino]benzamide |
| SMILES | CCCn1cccc1CNc1cc(C(N)=O)ccc1OC |
| InChI | InChI=1S/C16H21N3O2/c1-3-8-19-9-4-5-13(19)11-18-14-10-12(16(17)20)6-7-15(14)21-2/h4-7,9-10,18H,3,8,11H2,1-2H3,(H2,17,20) |
| InChIKey | GUWOJADYYYTHEE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |