C18H26N2 — CID 66412299
4-butan-2-yl-N-[(1-propylpyrrol-2-yl)methyl]aniline (PubChem CID 66412299) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-butan-2-yl-N-[(1-propylpyrrol-2-yl)methyl]aniline.
| Compound Name | 4-butan-2-yl-N-[(1-propylpyrrol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 66412299 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-butan-2-yl-N-[(1-propylpyrrol-2-yl)methyl]aniline |
| SMILES | CCCn1cccc1CNc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C18H26N2/c1-4-12-20-13-6-7-18(20)14-19-17-10-8-16(9-11-17)15(3)5-2/h6-11,13,15,19H,4-5,12,14H2,1-3H3 |
| InChIKey | KRBODYWOEMYMQP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |