C14H21N5S2 — CID 664126
5-[2-(dimethylamino)ethylsulfanyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 664126) has the molecular formula C14H21N5S2 and a molecular weight of 323.49 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylsulfanyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-[2-(dimethylamino)ethylsulfanyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 664126 |
| Molecular Formula | C14H21N5S2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-[2-(dimethylamino)ethylsulfanyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CN(C)CCSc1nc(N)c2c3c(sc2n1)CN(C)CC3 |
| InChI | InChI=1S/C14H21N5S2/c1-18(2)6-7-20-14-16-12(15)11-9-4-5-19(3)8-10(9)21-13(11)17-14/h4-8H2,1-3H3,(H2,15,16,17) |
| InChIKey | VIVCAVMKYXPBHO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |