C15H18N4OS — CID 66413414
2-methoxy-N-[[1-(1,3-thiazol-4-ylmethyl)pyrrolo[2,3-b]pyridin-3-yl]methyl]ethanamine (PubChem CID 66413414) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-methoxy-N-[[1-(1,3-thiazol-4-ylmethyl)pyrrolo[2,3-b]pyridin-3-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[1-(1,3-thiazol-4-ylmethyl)pyrrolo[2,3-b]pyridin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66413414 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-methoxy-N-[[1-(1,3-thiazol-4-ylmethyl)pyrrolo[2,3-b]pyridin-3-yl]methyl]ethanamine |
| SMILES | COCCNCc1cn(Cc2cscn2)c2ncccc12 |
| InChI | InChI=1S/C15H18N4OS/c1-20-6-5-16-7-12-8-19(9-13-10-21-11-18-13)15-14(12)3-2-4-17-15/h2-4,8,10-11,16H,5-7,9H2,1H3 |
| InChIKey | NAUYRGLNNWHRKR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|