C12H22N2O2 — CID 66413467
2-[2-[(1-propylpyrrol-2-yl)methylamino]ethoxy]ethanol (PubChem CID 66413467) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[2-[(1-propylpyrrol-2-yl)methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[(1-propylpyrrol-2-yl)methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 66413467 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-[2-[(1-propylpyrrol-2-yl)methylamino]ethoxy]ethanol |
| SMILES | CCCn1cccc1CNCCOCCO |
| InChI | InChI=1S/C12H22N2O2/c1-2-6-14-7-3-4-12(14)11-13-5-9-16-10-8-15/h3-4,7,13,15H,2,5-6,8-11H2,1H3 |
| InChIKey | CHSFIMKORRJTKL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|