C16H22N2 — CID 66413651
1-(4-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]methanamine (PubChem CID 66413651) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]methanamine.
| Compound Name | 1-(4-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 66413651 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-(4-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]methanamine |
| SMILES | CCCn1cccc1CNCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H22N2/c1-3-10-18-11-4-5-16(18)13-17-12-15-8-6-14(2)7-9-15/h4-9,11,17H,3,10,12-13H2,1-2H3 |
| InChIKey | OYWOVFSEBDJJMT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |