About 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile
5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 664138) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 664138 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccc(-c2nc(C#N)c(N3CCCCCC3)o2)cc1OC |
| InChI | InChI=1S/C18H21N3O3/c1-22-15-8-7-13(11-16(15)23-2)17-20-14(12-19)18(24-17)21-9-5-3-4-6-10-21/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | ZKMSQFNCYCQUPB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile (CID 664138) is 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile is COc1ccc(-c2nc(C#N)c(N3CCCCCC3)o2)cc1OC.
What is the InChIKey of 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile?
The InChIKey is ZKMSQFNCYCQUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3/c1-22-15-8-7-13(11-16(15)23-2)17-20-14(12-19)18(24-17)21-9-5-3-4-6-10-21/h7-8,11H,3-6,9-10H2,1-2H3.
What are the key properties of 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile?
5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile has a molecular weight of 327.38 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 664138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).