C32H33N3O6 — CID 6641412
(2S,3S,8R,10R)-2-[4-(2-hydroxyethoxy)phenyl]-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641412) has the molecular formula C32H33N3O6 and a molecular weight of 555.63 g/mol. Its IUPAC name is (2S,3S,8R,10R)-2-[4-(2-hydroxyethoxy)phenyl]-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2S,3S,8R,10R)-2-[4-(2-hydroxyethoxy)phenyl]-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641412 |
| Molecular Formula | C32H33N3O6 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | (2S,3S,8R,10R)-2-[4-(2-hydroxyethoxy)phenyl]-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)[C@@H](c3ccc(OCCO)cc3)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C32H33N3O6/c1-19-20(2)28(38)32(4)26(21-10-12-23(13-11-21)41-17-16-36)24-14-15-33-29(39)34(22-8-6-5-7-9-22)30(40)35(33)25(24)18-31(32,3)27(19)37/h5-14,25-26,36H,15-18H2,1-4H3/t25-,26+,31+,32-/m1/s1 |
| InChIKey | POYZZLWXGYVPTO-SGDGVZKBSA-N |
| XLogP | 3.34 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|