C14H19N3O — CID 66414856
3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)cyclohexan-1-ol (PubChem CID 66414856) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)cyclohexan-1-ol.
| Compound Name | 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 66414856 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)cyclohexan-1-ol |
| SMILES | OC1CCCC(NCc2c[nH]c3ncccc23)C1 |
| InChI | InChI=1S/C14H19N3O/c18-12-4-1-3-11(7-12)16-8-10-9-17-14-13(10)5-2-6-15-14/h2,5-6,9,11-12,16,18H,1,3-4,7-8H2,(H,15,17) |
| InChIKey | YOEFOWYQQJCKTR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |