C16H20N2O2 — CID 66415576
methyl 2-[(1-ethylpyrrol-3-yl)methylamino]-2-phenylacetate (PubChem CID 66415576) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is methyl 2-[(1-ethylpyrrol-3-yl)methylamino]-2-phenylacetate.
| Compound Name | methyl 2-[(1-ethylpyrrol-3-yl)methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 66415576 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | methyl 2-[(1-ethylpyrrol-3-yl)methylamino]-2-phenylacetate |
| SMILES | CCn1ccc(CNC(C(=O)OC)c2ccccc2)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-3-18-10-9-13(12-18)11-17-15(16(19)20-2)14-7-5-4-6-8-14/h4-10,12,15,17H,3,11H2,1-2H3 |
| InChIKey | FYGREEXSRVBKCX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |