About (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine
(1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine (PubChem CID 66415692) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine.
Molecular Properties
| Compound Name | (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine |
| PubChem CID | 66415692 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine |
| SMILES | CCCCCn1cc(CN)c2cccnc21 |
| InChI | InChI=1S/C13H19N3/c1-2-3-4-8-16-10-11(9-14)12-6-5-7-15-13(12)16/h5-7,10H,2-4,8-9,14H2,1H3 |
| InChIKey | FVPPCWDEAHDCEW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine?
The IUPAC name of (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine (CID 66415692) is (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine.
What is the SMILES notation for (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine?
The canonical SMILES for (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine is CCCCCn1cc(CN)c2cccnc21.
What is the InChIKey of (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine?
The InChIKey is FVPPCWDEAHDCEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-2-3-4-8-16-10-11(9-14)12-6-5-7-15-13(12)16/h5-7,10H,2-4,8-9,14H2,1H3.
What are the key properties of (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine?
(1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine has a molecular weight of 217.32 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pentylpyrrolo[2,3-b]pyridin-3-yl)methanamine is sourced from PubChem (CID 66415692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).