About 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine
2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine (PubChem CID 66415967) has the molecular formula C15H18F2N2
and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine |
| PubChem CID | 66415967 |
| Molecular Formula | C15H18F2N2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine |
| SMILES | CCn1ccc(CNCCc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C15H18F2N2/c1-2-19-6-4-13(11-19)10-18-5-3-12-7-14(16)9-15(17)8-12/h4,6-9,11,18H,2-3,5,10H2,1H3 |
| InChIKey | IDKOBSSVDGAAIZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine?
The IUPAC name of 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine (CID 66415967) is 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine.
What is the SMILES notation for 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine?
The canonical SMILES for 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine is CCn1ccc(CNCCc2cc(F)cc(F)c2)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine?
The InChIKey is IDKOBSSVDGAAIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2/c1-2-19-6-4-13(11-19)10-18-5-3-12-7-14(16)9-15(17)8-12/h4,6-9,11,18H,2-3,5,10H2,1H3.
What are the key properties of 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine?
2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine has a molecular weight of 264.32 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-N-[(1-ethylpyrrol-3-yl)methyl]ethanamine is sourced from PubChem (CID 66415967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).