C12H14F3N3O — CID 66416266
N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 66416266) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 66416266 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)COCCNCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C12H14F3N3O/c13-12(14,15)8-19-5-4-16-6-9-7-18-11-10(9)2-1-3-17-11/h1-3,7,16H,4-6,8H2,(H,17,18) |
| InChIKey | GWUVYPMSHBHHFO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|