C20H16BrN3O6 — CID 6641765
(2S,10R)-6-bromo-2-[5-(hydroxymethyl)furan-2-yl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 6641765) has the molecular formula C20H16BrN3O6 and a molecular weight of 474.27 g/mol. Its IUPAC name is (2S,10R)-6-bromo-2-[5-(hydroxymethyl)furan-2-yl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | (2S,10R)-6-bromo-2-[5-(hydroxymethyl)furan-2-yl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641765 |
| Molecular Formula | C20H16BrN3O6 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | (2S,10R)-6-bromo-2-[5-(hydroxymethyl)furan-2-yl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1CC3=C(C(=O)C=C(Br)C3=O)[C@@H](c3ccc(CO)o3)C1=CC2 |
| InChI | InChI=1S/C20H16BrN3O6/c1-22-19(28)23-5-4-10-13(24(23)20(22)29)6-11-16(14(26)7-12(21)18(11)27)17(10)15-3-2-9(8-25)30-15/h2-4,7,13,17,25H,5-6,8H2,1H3/t13-,17-/m1/s1 |
| InChIKey | NJIHDZTZWXOZGE-CXAGYDPISA-N |
| XLogP | 0.83 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|