C16H16FNO — CID 66417729
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-fluoro-4-methoxyaniline (PubChem CID 66417729) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-fluoro-4-methoxyaniline.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 66417729 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-fluoro-4-methoxyaniline |
| SMILES | COc1ccc(NCC2Cc3ccccc32)cc1F |
| InChI | InChI=1S/C16H16FNO/c1-19-16-7-6-13(9-15(16)17)18-10-12-8-11-4-2-3-5-14(11)12/h2-7,9,12,18H,8,10H2,1H3 |
| InChIKey | GKAOWNOFHNZAIK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|