C16H17N5 — CID 66418244
N-[(2-aminophenyl)methyl]-2-(2-methylimidazol-1-yl)pyridin-3-amine (PubChem CID 66418244) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-2-(2-methylimidazol-1-yl)pyridin-3-amine.
| Compound Name | N-[(2-aminophenyl)methyl]-2-(2-methylimidazol-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 66418244 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-2-(2-methylimidazol-1-yl)pyridin-3-amine |
| SMILES | Cc1nccn1-c1ncccc1NCc1ccccc1N |
| InChI | InChI=1S/C16H17N5/c1-12-18-9-10-21(12)16-15(7-4-8-19-16)20-11-13-5-2-3-6-14(13)17/h2-10,20H,11,17H2,1H3 |
| InChIKey | YGYFIIVOHICDCZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|