C18H20N2 — CID 66419132
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3,4-dihydro-2H-quinolin-7-amine (PubChem CID 66419132) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3,4-dihydro-2H-quinolin-7-amine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3,4-dihydro-2H-quinolin-7-amine |
|---|---|
| PubChem CID | 66419132 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3,4-dihydro-2H-quinolin-7-amine |
| SMILES | Nc1ccc2c(c1)N(CC1Cc3ccccc31)CCC2 |
| InChI | InChI=1S/C18H20N2/c19-16-8-7-13-5-3-9-20(18(13)11-16)12-15-10-14-4-1-2-6-17(14)15/h1-2,4,6-8,11,15H,3,5,9-10,12,19H2 |
| InChIKey | HKXQYGYXHDOMIC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|