C17H19NO — CID 66419657
3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,4-dimethylaniline (PubChem CID 66419657) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,4-dimethylaniline.
| Compound Name | 3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,4-dimethylaniline |
|---|---|
| PubChem CID | 66419657 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,4-dimethylaniline |
| SMILES | Cc1ccc(N)c(C)c1OCC1Cc2ccccc21 |
| InChI | InChI=1S/C17H19NO/c1-11-7-8-16(18)12(2)17(11)19-10-14-9-13-5-3-4-6-15(13)14/h3-8,14H,9-10,18H2,1-2H3 |
| InChIKey | AFYWAFKOYDOHJM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|