C18H20N2O4 — CID 664204
(2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-3-phenylpropanoic acid (PubChem CID 664204) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 664204 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2S)-2-[(2-methoxyphenyl)methylcarbamoylamino]-3-phenylpropanoic acid |
| SMILES | COc1ccccc1CNC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O4/c1-24-16-10-6-5-9-14(16)12-19-18(23)20-15(17(21)22)11-13-7-3-2-4-8-13/h2-10,15H,11-12H2,1H3,(H,21,22)(H2,19,20,23)/t15-/m0/s1 |
| InChIKey | ZZSVRRXTGNHXKH-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |