2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid

C11H16N4O4 — CID 66421547

IUPAC2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid
SMILESO=C(O)CC1CN(C(=O)CCn2cncn2)CCO1
InChIInChI=1S/C11H16N4O4/c16-10(1-2-15-8-12-7-13-15)14-3-4-19-9(6-14)5-11(17)18/h7-9H,1-6H2,(H,17,18)
InChIKeyQSKNOVDDILWNOZ-UHFFFAOYSA-N
MW268.27 g/mol
LogP-0.63
Rot. Bonds5

About 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid

2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid (PubChem CID 66421547) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid
PubChem CID66421547
Molecular FormulaC11H16N4O4
Molecular Weight268.27 g/mol
Exact Mass268.12
IUPAC Name2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid
SMILESO=C(O)CC1CN(C(=O)CCn2cncn2)CCO1
InChIInChI=1S/C11H16N4O4/c16-10(1-2-15-8-12-7-13-15)14-3-4-19-9(6-14)5-11(17)18/h7-9H,1-6H2,(H,17,18)
InChIKeyQSKNOVDDILWNOZ-UHFFFAOYSA-N
XLogP-0.63
TPSA97.55 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 5-0.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid?
The IUPAC name of 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid (CID 66421547) is 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid.
What is the SMILES notation for 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid?
The canonical SMILES for 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid is O=C(O)CC1CN(C(=O)CCn2cncn2)CCO1.
What is the InChIKey of 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid?
The InChIKey is QSKNOVDDILWNOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O4/c16-10(1-2-15-8-12-7-13-15)14-3-4-19-9(6-14)5-11(17)18/h7-9H,1-6H2,(H,17,18).
What are the key properties of 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid?
2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid has a molecular weight of 268.27 g/mol, XLogP of -0.63, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(1,2,4-triazol-1-yl)propanoyl]morpholin-2-yl]acetic acid is sourced from PubChem (CID 66421547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).