C26H15Cl2F5N2O5 — CID 6642166
(3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6642166) has the molecular formula C26H15Cl2F5N2O5 and a molecular weight of 601.31 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6642166 |
| Molecular Formula | C26H15Cl2F5N2O5 |
| Molecular Weight | 601.31 g/mol |
| Exact Mass | 600.03 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1NC(=O)[C@H]2CC=C3[C@@H](C[C@@]4(Cl)C(=O)N(c5c(F)c(F)c(F)c(F)c5F)C(=O)[C@@]4(Cl)[C@H]3c3ccccc3O)[C@@H]12 |
| InChI | InChI=1S/C26H15Cl2F5N2O5/c27-25-7-11-8(5-6-10-13(11)22(38)34-21(10)37)14(9-3-1-2-4-12(9)36)26(25,28)24(40)35(23(25)39)20-18(32)16(30)15(29)17(31)19(20)33/h1-5,10-11,13-14,36H,6-7H2,(H,34,37,38)/t10-,11+,13-,14+,25+,26-/m0/s1 |
| InChIKey | WZXIIDOEASGAIT-VRHNBJEASA-N |
| XLogP | 3.94 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|