C13H22N2OS — CID 66422161
N-ethyl-N-(furan-2-ylmethyl)-2-thiomorpholin-3-ylethanamine (PubChem CID 66422161) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is N-ethyl-N-(furan-2-ylmethyl)-2-thiomorpholin-3-ylethanamine.
| Compound Name | N-ethyl-N-(furan-2-ylmethyl)-2-thiomorpholin-3-ylethanamine |
|---|---|
| PubChem CID | 66422161 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-ethyl-N-(furan-2-ylmethyl)-2-thiomorpholin-3-ylethanamine |
| SMILES | CCN(CCC1CSCCN1)Cc1ccco1 |
| InChI | InChI=1S/C13H22N2OS/c1-2-15(10-13-4-3-8-16-13)7-5-12-11-17-9-6-14-12/h3-4,8,12,14H,2,5-7,9-11H2,1H3 |
| InChIKey | QBOOLTHRDWQDJQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |