About N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide
N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 66422455) has the molecular formula C11H18F3N3O2S
and a molecular weight of 313.35 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide.
Molecular Properties
| Compound Name | N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide |
| PubChem CID | 66422455 |
| Molecular Formula | C11H18F3N3O2S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CN(CC(=O)NCC(F)(F)F)C(=O)CC1CSCCN1 |
| InChI | InChI=1S/C11H18F3N3O2S/c1-17(5-9(18)16-7-11(12,13)14)10(19)4-8-6-20-3-2-15-8/h8,15H,2-7H2,1H3,(H,16,18) |
| InChIKey | GBSQUGCHQJSYPM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide?
The IUPAC name of N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide (CID 66422455) is N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide.
What is the SMILES notation for N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide?
The canonical SMILES for N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide is CN(CC(=O)NCC(F)(F)F)C(=O)CC1CSCCN1.
What is the InChIKey of N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide?
The InChIKey is GBSQUGCHQJSYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3N3O2S/c1-17(5-9(18)16-7-11(12,13)14)10(19)4-8-6-20-3-2-15-8/h8,15H,2-7H2,1H3,(H,16,18).
What are the key properties of N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide?
N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide has a molecular weight of 313.35 g/mol, XLogP of 0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-thiomorpholin-3-ylacetamide is sourced from PubChem (CID 66422455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).