About 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide
3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide (PubChem CID 66423392) has the molecular formula C9H12ClN3O3
and a molecular weight of 245.67 g/mol. Its IUPAC name is 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide.
Molecular Properties
| Compound Name | 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide |
| PubChem CID | 66423392 |
| Molecular Formula | C9H12ClN3O3 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCn1cc(Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12ClN3O3/c1-2-11-7(14)3-4-13-5-6(10)8(15)12-9(13)16/h5H,2-4H2,1H3,(H,11,14)(H,12,15,16) |
| InChIKey | QYEYWWBFXGGIJK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide?
The IUPAC name of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide (CID 66423392) is 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide.
What is the SMILES notation for 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide?
The canonical SMILES for 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide is CCNC(=O)CCn1cc(Cl)c(=O)[nH]c1=O.
What is the InChIKey of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide?
The InChIKey is QYEYWWBFXGGIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN3O3/c1-2-11-7(14)3-4-13-5-6(10)8(15)12-9(13)16/h5H,2-4H2,1H3,(H,11,14)(H,12,15,16).
What are the key properties of 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide?
3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide has a molecular weight of 245.67 g/mol, XLogP of -0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2,4-dioxopyrimidin-1-yl)-N-ethylpropanamide is sourced from PubChem (CID 66423392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).