About 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea
3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea (PubChem CID 664234) has the molecular formula C23H30ClN3O4
and a molecular weight of 447.96 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea |
| PubChem CID | 664234 |
| Molecular Formula | C23H30ClN3O4 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea |
| SMILES | COc1ccc(CN(CCCN2CCOCC2)C(=O)Nc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C23H30ClN3O4/c1-29-21-8-7-18(15-22(21)30-2)17-27(10-4-9-26-11-13-31-14-12-26)23(28)25-20-6-3-5-19(24)16-20/h3,5-8,15-16H,4,9-14,17H2,1-2H3,(H,25,28) |
| InChIKey | IXVFBDGOVBONJZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea?
The IUPAC name of 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea (CID 664234) is 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea.
What is the SMILES notation for 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea?
The canonical SMILES for 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea is COc1ccc(CN(CCCN2CCOCC2)C(=O)Nc2cccc(Cl)c2)cc1OC.
What is the InChIKey of 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea?
The InChIKey is IXVFBDGOVBONJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30ClN3O4/c1-29-21-8-7-18(15-22(21)30-2)17-27(10-4-9-26-11-13-31-14-12-26)23(28)25-20-6-3-5-19(24)16-20/h3,5-8,15-16H,4,9-14,17H2,1-2H3,(H,25,28).
What are the key properties of 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea?
3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea has a molecular weight of 447.96 g/mol, XLogP of 4.11, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea is sourced from PubChem (CID 664234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).