C14H21N — CID 66423749
N-methyl-1-[2-methyl-1-(3-methylphenyl)cyclobutyl]methanamine (PubChem CID 66423749) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-methyl-1-[2-methyl-1-(3-methylphenyl)cyclobutyl]methanamine.
| Compound Name | N-methyl-1-[2-methyl-1-(3-methylphenyl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 66423749 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-methyl-1-[2-methyl-1-(3-methylphenyl)cyclobutyl]methanamine |
| SMILES | CNCC1(c2cccc(C)c2)CCC1C |
| InChI | InChI=1S/C14H21N/c1-11-5-4-6-13(9-11)14(10-15-3)8-7-12(14)2/h4-6,9,12,15H,7-8,10H2,1-3H3 |
| InChIKey | REDNMGCGFYUDKV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |