About 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide
4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide (PubChem CID 66424002) has the molecular formula C12H11ClN4O3
and a molecular weight of 294.70 g/mol. Its IUPAC name is 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide.
Molecular Properties
| Compound Name | 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide |
| PubChem CID | 66424002 |
| Molecular Formula | C12H11ClN4O3 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(Cn2cc(Cl)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H11ClN4O3/c13-9-6-17(12(20)15-11(9)19)5-7-1-3-8(4-2-7)10(18)16-14/h1-4,6H,5,14H2,(H,16,18)(H,15,19,20) |
| InChIKey | QJAYSCQKSXEGEG-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide?
The IUPAC name of 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide (CID 66424002) is 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide.
What is the SMILES notation for 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide?
The canonical SMILES for 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide is NNC(=O)c1ccc(Cn2cc(Cl)c(=O)[nH]c2=O)cc1.
What is the InChIKey of 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide?
The InChIKey is QJAYSCQKSXEGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN4O3/c13-9-6-17(12(20)15-11(9)19)5-7-1-3-8(4-2-7)10(18)16-14/h1-4,6H,5,14H2,(H,16,18)(H,15,19,20).
What are the key properties of 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide?
4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide has a molecular weight of 294.70 g/mol, XLogP of -0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide is sourced from PubChem (CID 66424002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).