About N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine
N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine (PubChem CID 66424142) has the molecular formula C15H19Cl2N
and a molecular weight of 284.23 g/mol. Its IUPAC name is N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine |
| PubChem CID | 66424142 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine |
| SMILES | CC1CCC1(CNC1CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N/c1-10-6-7-15(10,9-18-12-3-4-12)11-2-5-13(16)14(17)8-11/h2,5,8,10,12,18H,3-4,6-7,9H2,1H3 |
| InChIKey | SLFYSVLOSQVCLG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine?
The IUPAC name of N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine (CID 66424142) is N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine?
The canonical SMILES for N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine is CC1CCC1(CNC1CC1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine?
The InChIKey is SLFYSVLOSQVCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N/c1-10-6-7-15(10,9-18-12-3-4-12)11-2-5-13(16)14(17)8-11/h2,5,8,10,12,18H,3-4,6-7,9H2,1H3.
What are the key properties of N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine?
N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine has a molecular weight of 284.23 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(3,4-dichlorophenyl)-2-methylcyclobutyl]methyl]cyclopropanamine is sourced from PubChem (CID 66424142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).